C21H24ClFN2O3S — CID 43028000
4-chloro-N-ethyl-N-[(3-fluorophenyl)methyl]-3-piperidin-1-ylsulfonylbenzamide (PubChem CID 43028000) has the molecular formula C21H24ClFN2O3S and a molecular weight of 438.95 g/mol. Its IUPAC name is 4-chloro-N-ethyl-N-[(3-fluorophenyl)methyl]-3-piperidin-1-ylsulfonylbenzamide.
| Compound Name | 4-chloro-N-ethyl-N-[(3-fluorophenyl)methyl]-3-piperidin-1-ylsulfonylbenzamide |
|---|---|
| PubChem CID | 43028000 |
| Molecular Formula | C21H24ClFN2O3S |
| Molecular Weight | 438.95 g/mol |
| Exact Mass | 438.12 |
| IUPAC Name | 4-chloro-N-ethyl-N-[(3-fluorophenyl)methyl]-3-piperidin-1-ylsulfonylbenzamide |
| SMILES | CCN(Cc1cccc(F)c1)C(=O)c1ccc(Cl)c(S(=O)(=O)N2CCCCC2)c1 |
| InChI | InChI=1S/C21H24ClFN2O3S/c1-2-24(15-16-7-6-8-18(23)13-16)21(26)17-9-10-19(22)20(14-17)29(27,28)25-11-4-3-5-12-25/h6-10,13-14H,2-5,11-12,15H2,1H3 |
| InChIKey | ZNIVDNZRYOCBGK-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.95 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |