C19H29ClN2O3S — CID 2359100
N,N-dibutyl-4-chloro-3-pyrrolidin-1-ylsulfonylbenzamide (PubChem CID 2359100) has the molecular formula C19H29ClN2O3S and a molecular weight of 400.97 g/mol. Its IUPAC name is N,N-dibutyl-4-chloro-3-pyrrolidin-1-ylsulfonylbenzamide.
| Compound Name | N,N-dibutyl-4-chloro-3-pyrrolidin-1-ylsulfonylbenzamide |
|---|---|
| PubChem CID | 2359100 |
| Molecular Formula | C19H29ClN2O3S |
| Molecular Weight | 400.97 g/mol |
| Exact Mass | 400.16 |
| IUPAC Name | N,N-dibutyl-4-chloro-3-pyrrolidin-1-ylsulfonylbenzamide |
| SMILES | CCCCN(CCCC)C(=O)c1ccc(Cl)c(S(=O)(=O)N2CCCC2)c1 |
| InChI | InChI=1S/C19H29ClN2O3S/c1-3-5-11-21(12-6-4-2)19(23)16-9-10-17(20)18(15-16)26(24,25)22-13-7-8-14-22/h9-10,15H,3-8,11-14H2,1-2H3 |
| InChIKey | WZCFSGFHTOMPTA-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.97 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |