C16H22ClN3O4S — CID 9226980
4-chloro-N-[2-(dimethylamino)-2-oxoethyl]-N-methyl-3-pyrrolidin-1-ylsulfonylbenzamide (PubChem CID 9226980) has the molecular formula C16H22ClN3O4S and a molecular weight of 387.89 g/mol. Its IUPAC name is 4-chloro-N-[2-(dimethylamino)-2-oxoethyl]-N-methyl-3-pyrrolidin-1-ylsulfonylbenzamide.
| Compound Name | 4-chloro-N-[2-(dimethylamino)-2-oxoethyl]-N-methyl-3-pyrrolidin-1-ylsulfonylbenzamide |
|---|---|
| PubChem CID | 9226980 |
| Molecular Formula | C16H22ClN3O4S |
| Molecular Weight | 387.89 g/mol |
| Exact Mass | 387.10 |
| IUPAC Name | 4-chloro-N-[2-(dimethylamino)-2-oxoethyl]-N-methyl-3-pyrrolidin-1-ylsulfonylbenzamide |
| SMILES | CN(C)C(=O)CN(C)C(=O)c1ccc(Cl)c(S(=O)(=O)N2CCCC2)c1 |
| InChI | InChI=1S/C16H22ClN3O4S/c1-18(2)15(21)11-19(3)16(22)12-6-7-13(17)14(10-12)25(23,24)20-8-4-5-9-20/h6-7,10H,4-5,8-9,11H2,1-3H3 |
| InChIKey | AGZUMRAAVYMBHS-UHFFFAOYSA-N |
| XLogP | 1.28 |
| TPSA | 78.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.89 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |