C17H13ClN4O2 — CID 18132685
(2-chloro-4-cyanophenyl) 1-propan-2-ylpyrazolo[3,4-b]pyridine-5-carboxylate (PubChem CID 18132685) has the molecular formula C17H13ClN4O2 and a molecular weight of 340.77 g/mol. Its IUPAC name is (2-chloro-4-cyanophenyl) 1-propan-2-ylpyrazolo[3,4-b]pyridine-5-carboxylate.
| Compound Name | (2-chloro-4-cyanophenyl) 1-propan-2-ylpyrazolo[3,4-b]pyridine-5-carboxylate |
|---|---|
| PubChem CID | 18132685 |
| Molecular Formula | C17H13ClN4O2 |
| Molecular Weight | 340.77 g/mol |
| Exact Mass | 340.07 |
| IUPAC Name | (2-chloro-4-cyanophenyl) 1-propan-2-ylpyrazolo[3,4-b]pyridine-5-carboxylate |
| SMILES | CC(C)n1ncc2cc(C(=O)Oc3ccc(C#N)cc3Cl)cnc21 |
| InChI | InChI=1S/C17H13ClN4O2/c1-10(2)22-16-12(9-21-22)6-13(8-20-16)17(23)24-15-4-3-11(7-19)5-14(15)18/h3-6,8-10H,1-2H3 |
| InChIKey | FBBKGZLNFKWQGD-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 80.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.77 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|