C22H30N4O3 — CID 18133630
N-[2-[(6-morpholin-4-yl-3-pyridinyl)amino]-2-oxoethyl]adamantane-1-carboxamide (PubChem CID 18133630) has the molecular formula C22H30N4O3 and a molecular weight of 398.51 g/mol. Its IUPAC name is N-[2-[(6-morpholin-4-yl-3-pyridinyl)amino]-2-oxoethyl]adamantane-1-carboxamide.
| Compound Name | N-[2-[(6-morpholin-4-yl-3-pyridinyl)amino]-2-oxoethyl]adamantane-1-carboxamide |
|---|---|
| PubChem CID | 18133630 |
| Molecular Formula | C22H30N4O3 |
| Molecular Weight | 398.51 g/mol |
| Exact Mass | 398.23 |
| IUPAC Name | N-[2-[(6-morpholin-4-yl-3-pyridinyl)amino]-2-oxoethyl]adamantane-1-carboxamide |
| SMILES | O=C(CNC(=O)C12CC3CC(CC(C3)C1)C2)Nc1ccc(N2CCOCC2)nc1 |
| InChI | InChI=1S/C22H30N4O3/c27-20(25-18-1-2-19(23-13-18)26-3-5-29-6-4-26)14-24-21(28)22-10-15-7-16(11-22)9-17(8-15)12-22/h1-2,13,15-17H,3-12,14H2,(H,24,28)(H,25,27) |
| InChIKey | HSUOAJNVYIXRFV-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 83.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.51 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |