C24H30N2O3S — CID 18134013
2-(6-methylspiro[2,3,6,8-tetrahydro-[1,4]dioxino[2,3-g]isoquinoline-9,1'-cyclopentane]-7-yl)-N-(2-thiophen-2-ylethyl)acetamide (PubChem CID 18134013) has the molecular formula C24H30N2O3S and a molecular weight of 426.58 g/mol. Its IUPAC name is 2-(6-methylspiro[2,3,6,8-tetrahydro-[1,4]dioxino[2,3-g]isoquinoline-9,1'-cyclopentane]-7-yl)-N-(2-thiophen-2-ylethyl)acetamide.
| Compound Name | 2-(6-methylspiro[2,3,6,8-tetrahydro-[1,4]dioxino[2,3-g]isoquinoline-9,1'-cyclopentane]-7-yl)-N-(2-thiophen-2-ylethyl)acetamide |
|---|---|
| PubChem CID | 18134013 |
| Molecular Formula | C24H30N2O3S |
| Molecular Weight | 426.58 g/mol |
| Exact Mass | 426.20 |
| IUPAC Name | 2-(6-methylspiro[2,3,6,8-tetrahydro-[1,4]dioxino[2,3-g]isoquinoline-9,1'-cyclopentane]-7-yl)-N-(2-thiophen-2-ylethyl)acetamide |
| SMILES | CC1c2cc3c(cc2C2(CCCC2)CN1CC(=O)NCCc1cccs1)OCCO3 |
| InChI | InChI=1S/C24H30N2O3S/c1-17-19-13-21-22(29-11-10-28-21)14-20(19)24(7-2-3-8-24)16-26(17)15-23(27)25-9-6-18-5-4-12-30-18/h4-5,12-14,17H,2-3,6-11,15-16H2,1H3,(H,25,27) |
| InChIKey | BHGVYYRBRIRUNF-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.58 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |