C23H30N2O4 — CID 18137192
2-[4-[2-(3,5-dimethoxyphenyl)ethyl]piperidin-1-yl]-N-(4-hydroxyphenyl)acetamide (PubChem CID 18137192) has the molecular formula C23H30N2O4 and a molecular weight of 398.50 g/mol. Its IUPAC name is 2-[4-[2-(3,5-dimethoxyphenyl)ethyl]piperidin-1-yl]-N-(4-hydroxyphenyl)acetamide.
| Compound Name | 2-[4-[2-(3,5-dimethoxyphenyl)ethyl]piperidin-1-yl]-N-(4-hydroxyphenyl)acetamide |
|---|---|
| PubChem CID | 18137192 |
| Molecular Formula | C23H30N2O4 |
| Molecular Weight | 398.50 g/mol |
| Exact Mass | 398.22 |
| IUPAC Name | 2-[4-[2-(3,5-dimethoxyphenyl)ethyl]piperidin-1-yl]-N-(4-hydroxyphenyl)acetamide |
| SMILES | COc1cc(CCC2CCN(CC(=O)Nc3ccc(O)cc3)CC2)cc(OC)c1 |
| InChI | InChI=1S/C23H30N2O4/c1-28-21-13-18(14-22(15-21)29-2)4-3-17-9-11-25(12-10-17)16-23(27)24-19-5-7-20(26)8-6-19/h5-8,13-15,17,26H,3-4,9-12,16H2,1-2H3,(H,24,27) |
| InChIKey | HVTVBLUPSLQUAV-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 71.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.50 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|