C20H23NO2S — CID 18139455
4-(5-methylthiophen-2-yl)-4-oxo-N-[(1-phenylcyclobutyl)methyl]butanamide (PubChem CID 18139455) has the molecular formula C20H23NO2S and a molecular weight of 341.48 g/mol. Its IUPAC name is 4-(5-methylthiophen-2-yl)-4-oxo-N-[(1-phenylcyclobutyl)methyl]butanamide.
| Compound Name | 4-(5-methylthiophen-2-yl)-4-oxo-N-[(1-phenylcyclobutyl)methyl]butanamide |
|---|---|
| PubChem CID | 18139455 |
| Molecular Formula | C20H23NO2S |
| Molecular Weight | 341.48 g/mol |
| Exact Mass | 341.14 |
| IUPAC Name | 4-(5-methylthiophen-2-yl)-4-oxo-N-[(1-phenylcyclobutyl)methyl]butanamide |
| SMILES | Cc1ccc(C(=O)CCC(=O)NCC2(c3ccccc3)CCC2)s1 |
| InChI | InChI=1S/C20H23NO2S/c1-15-8-10-18(24-15)17(22)9-11-19(23)21-14-20(12-5-13-20)16-6-3-2-4-7-16/h2-4,6-8,10H,5,9,11-14H2,1H3,(H,21,23) |
| InChIKey | XMIOBXDWBLZGQV-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.48 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |