C21H33N2O2S+ — CID 9112477
4-(5-methylthiophen-2-yl)-4-oxo-N-[(1-piperidin-1-ium-1-ylcyclohexyl)methyl]butanamide (PubChem CID 9112477) has the molecular formula C21H33N2O2S+ and a molecular weight of 377.57 g/mol. Its IUPAC name is 4-(5-methylthiophen-2-yl)-4-oxo-N-[(1-piperidin-1-ium-1-ylcyclohexyl)methyl]butanamide.
| Compound Name | 4-(5-methylthiophen-2-yl)-4-oxo-N-[(1-piperidin-1-ium-1-ylcyclohexyl)methyl]butanamide |
|---|---|
| PubChem CID | 9112477 |
| Molecular Formula | C21H33N2O2S+ |
| Molecular Weight | 377.57 g/mol |
| Exact Mass | 377.23 |
| IUPAC Name | 4-(5-methylthiophen-2-yl)-4-oxo-N-[(1-piperidin-1-ium-1-ylcyclohexyl)methyl]butanamide |
| SMILES | Cc1ccc(C(=O)CCC(=O)NCC2([NH+]3CCCCC3)CCCCC2)s1 |
| InChI | InChI=1S/C21H32N2O2S/c1-17-8-10-19(26-17)18(24)9-11-20(25)22-16-21(12-4-2-5-13-21)23-14-6-3-7-15-23/h8,10H,2-7,9,11-16H2,1H3,(H,22,25)/p+1 |
| InChIKey | WVQORQXMJKRBEK-UHFFFAOYSA-O |
| XLogP | 2.91 |
| TPSA | 50.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.57 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |