C24H33N2O4+ — CID 7930145
2-(4-methyl-2-oxochromen-7-yl)oxy-N-[(1-piperidin-1-ium-1-ylcyclohexyl)methyl]acetamide (PubChem CID 7930145) has the molecular formula C24H33N2O4+ and a molecular weight of 413.54 g/mol. Its IUPAC name is 2-(4-methyl-2-oxochromen-7-yl)oxy-N-[(1-piperidin-1-ium-1-ylcyclohexyl)methyl]acetamide.
| Compound Name | 2-(4-methyl-2-oxochromen-7-yl)oxy-N-[(1-piperidin-1-ium-1-ylcyclohexyl)methyl]acetamide |
|---|---|
| PubChem CID | 7930145 |
| Molecular Formula | C24H33N2O4+ |
| Molecular Weight | 413.54 g/mol |
| Exact Mass | 413.24 |
| IUPAC Name | 2-(4-methyl-2-oxochromen-7-yl)oxy-N-[(1-piperidin-1-ium-1-ylcyclohexyl)methyl]acetamide |
| SMILES | Cc1cc(=O)oc2cc(OCC(=O)NCC3([NH+]4CCCCC4)CCCCC3)ccc12 |
| InChI | InChI=1S/C24H32N2O4/c1-18-14-23(28)30-21-15-19(8-9-20(18)21)29-16-22(27)25-17-24(10-4-2-5-11-24)26-12-6-3-7-13-26/h8-9,14-15H,2-7,10-13,16-17H2,1H3,(H,25,27)/p+1 |
| InChIKey | HLLNKADDUGSUKF-UHFFFAOYSA-O |
| XLogP | 2.37 |
| TPSA | 72.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.54 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|