C14H13ClN4O2S — CID 18140859
5-[(5-chloro-2-methoxyphenyl)methylsulfanyl]-1-(furan-2-ylmethyl)tetrazole (PubChem CID 18140859) has the molecular formula C14H13ClN4O2S and a molecular weight of 336.80 g/mol. Its IUPAC name is 5-[(5-chloro-2-methoxyphenyl)methylsulfanyl]-1-(furan-2-ylmethyl)tetrazole.
| Compound Name | 5-[(5-chloro-2-methoxyphenyl)methylsulfanyl]-1-(furan-2-ylmethyl)tetrazole |
|---|---|
| PubChem CID | 18140859 |
| Molecular Formula | C14H13ClN4O2S |
| Molecular Weight | 336.80 g/mol |
| Exact Mass | 336.04 |
| IUPAC Name | 5-[(5-chloro-2-methoxyphenyl)methylsulfanyl]-1-(furan-2-ylmethyl)tetrazole |
| SMILES | COc1ccc(Cl)cc1CSc1nnnn1Cc1ccco1 |
| InChI | InChI=1S/C14H13ClN4O2S/c1-20-13-5-4-11(15)7-10(13)9-22-14-16-17-18-19(14)8-12-3-2-6-21-12/h2-7H,8-9H2,1H3 |
| InChIKey | CJPRNSKDKIWAGM-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 65.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.80 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |