C21H21N5S — CID 18140999
3-[(1,3-diphenylpyrazol-4-yl)methylsulfanyl]-5-propyl-1H-1,2,4-triazole (PubChem CID 18140999) has the molecular formula C21H21N5S and a molecular weight of 375.50 g/mol. Its IUPAC name is 3-[(1,3-diphenylpyrazol-4-yl)methylsulfanyl]-5-propyl-1H-1,2,4-triazole.
| Compound Name | 3-[(1,3-diphenylpyrazol-4-yl)methylsulfanyl]-5-propyl-1H-1,2,4-triazole |
|---|---|
| PubChem CID | 18140999 |
| Molecular Formula | C21H21N5S |
| Molecular Weight | 375.50 g/mol |
| Exact Mass | 375.15 |
| IUPAC Name | 3-[(1,3-diphenylpyrazol-4-yl)methylsulfanyl]-5-propyl-1H-1,2,4-triazole |
| SMILES | CCCc1nc(SCc2cn(-c3ccccc3)nc2-c2ccccc2)n[nH]1 |
| InChI | InChI=1S/C21H21N5S/c1-2-9-19-22-21(24-23-19)27-15-17-14-26(18-12-7-4-8-13-18)25-20(17)16-10-5-3-6-11-16/h3-8,10-14H,2,9,15H2,1H3,(H,22,23,24) |
| InChIKey | YZVMKZTYEPYAJV-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 59.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.50 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |