C24H24N2O5 — CID 18141468
[2-[benzyl(ethyl)amino]-2-oxoethyl] 2-(furan-2-carbonylamino)-3-methylbenzoate (PubChem CID 18141468) has the molecular formula C24H24N2O5 and a molecular weight of 420.47 g/mol. Its IUPAC name is [2-[benzyl(ethyl)amino]-2-oxoethyl] 2-(furan-2-carbonylamino)-3-methylbenzoate.
| Compound Name | [2-[benzyl(ethyl)amino]-2-oxoethyl] 2-(furan-2-carbonylamino)-3-methylbenzoate |
|---|---|
| PubChem CID | 18141468 |
| Molecular Formula | C24H24N2O5 |
| Molecular Weight | 420.47 g/mol |
| Exact Mass | 420.17 |
| IUPAC Name | [2-[benzyl(ethyl)amino]-2-oxoethyl] 2-(furan-2-carbonylamino)-3-methylbenzoate |
| SMILES | CCN(Cc1ccccc1)C(=O)COC(=O)c1cccc(C)c1NC(=O)c1ccco1 |
| InChI | InChI=1S/C24H24N2O5/c1-3-26(15-18-10-5-4-6-11-18)21(27)16-31-24(29)19-12-7-9-17(2)22(19)25-23(28)20-13-8-14-30-20/h4-14H,3,15-16H2,1-2H3,(H,25,28) |
| InChIKey | ZPMRRJYVLHNCRN-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 88.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.47 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |