C19H25N5O3 — CID 18144616
N-[2-(3,4-dimethoxyphenyl)ethyl]-4-pyrazin-2-ylpiperazine-1-carboxamide (PubChem CID 18144616) has the molecular formula C19H25N5O3 and a molecular weight of 371.44 g/mol. Its IUPAC name is N-[2-(3,4-dimethoxyphenyl)ethyl]-4-pyrazin-2-ylpiperazine-1-carboxamide.
| Compound Name | N-[2-(3,4-dimethoxyphenyl)ethyl]-4-pyrazin-2-ylpiperazine-1-carboxamide |
|---|---|
| PubChem CID | 18144616 |
| Molecular Formula | C19H25N5O3 |
| Molecular Weight | 371.44 g/mol |
| Exact Mass | 371.20 |
| IUPAC Name | N-[2-(3,4-dimethoxyphenyl)ethyl]-4-pyrazin-2-ylpiperazine-1-carboxamide |
| SMILES | COc1ccc(CCNC(=O)N2CCN(c3cnccn3)CC2)cc1OC |
| InChI | InChI=1S/C19H25N5O3/c1-26-16-4-3-15(13-17(16)27-2)5-6-22-19(25)24-11-9-23(10-12-24)18-14-20-7-8-21-18/h3-4,7-8,13-14H,5-6,9-12H2,1-2H3,(H,22,25) |
| InChIKey | DUFSSEBSNMDMTH-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 79.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.44 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |