C16H14F2N4O4 — CID 18145311
[1-(difluoromethyl)imidazol-2-yl]methyl 2-[(2,5-dioxoimidazolidin-1-yl)methyl]benzoate (PubChem CID 18145311) has the molecular formula C16H14F2N4O4 and a molecular weight of 364.31 g/mol. Its IUPAC name is [1-(difluoromethyl)imidazol-2-yl]methyl 2-[(2,5-dioxoimidazolidin-1-yl)methyl]benzoate.
| Compound Name | [1-(difluoromethyl)imidazol-2-yl]methyl 2-[(2,5-dioxoimidazolidin-1-yl)methyl]benzoate |
|---|---|
| PubChem CID | 18145311 |
| Molecular Formula | C16H14F2N4O4 |
| Molecular Weight | 364.31 g/mol |
| Exact Mass | 364.10 |
| IUPAC Name | [1-(difluoromethyl)imidazol-2-yl]methyl 2-[(2,5-dioxoimidazolidin-1-yl)methyl]benzoate |
| SMILES | O=C(OCc1nccn1C(F)F)c1ccccc1CN1C(=O)CNC1=O |
| InChI | InChI=1S/C16H14F2N4O4/c17-15(18)21-6-5-19-12(21)9-26-14(24)11-4-2-1-3-10(11)8-22-13(23)7-20-16(22)25/h1-6,15H,7-9H2,(H,20,25) |
| InChIKey | PTYPXKCRMFBFLQ-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 93.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.31 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|