C16H19N5O2S — CID 18146017
5-methyl-N-[2-oxo-2-(4-pyrazin-2-ylpiperazin-1-yl)ethyl]thiophene-2-carboxamide (PubChem CID 18146017) has the molecular formula C16H19N5O2S and a molecular weight of 345.43 g/mol. Its IUPAC name is 5-methyl-N-[2-oxo-2-(4-pyrazin-2-ylpiperazin-1-yl)ethyl]thiophene-2-carboxamide.
| Compound Name | 5-methyl-N-[2-oxo-2-(4-pyrazin-2-ylpiperazin-1-yl)ethyl]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 18146017 |
| Molecular Formula | C16H19N5O2S |
| Molecular Weight | 345.43 g/mol |
| Exact Mass | 345.13 |
| IUPAC Name | 5-methyl-N-[2-oxo-2-(4-pyrazin-2-ylpiperazin-1-yl)ethyl]thiophene-2-carboxamide |
| SMILES | Cc1ccc(C(=O)NCC(=O)N2CCN(c3cnccn3)CC2)s1 |
| InChI | InChI=1S/C16H19N5O2S/c1-12-2-3-13(24-12)16(23)19-11-15(22)21-8-6-20(7-9-21)14-10-17-4-5-18-14/h2-5,10H,6-9,11H2,1H3,(H,19,23) |
| InChIKey | VRFCRTYATSTTFD-UHFFFAOYSA-N |
| XLogP | 0.93 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.43 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |