C18H22N4O2S — CID 25453222
N-[[2-(4-acetylpiperazin-1-yl)-3-pyridinyl]methyl]-5-methylthiophene-2-carboxamide (PubChem CID 25453222) has the molecular formula C18H22N4O2S and a molecular weight of 358.47 g/mol. Its IUPAC name is N-[[2-(4-acetylpiperazin-1-yl)-3-pyridinyl]methyl]-5-methylthiophene-2-carboxamide.
| Compound Name | N-[[2-(4-acetylpiperazin-1-yl)-3-pyridinyl]methyl]-5-methylthiophene-2-carboxamide |
|---|---|
| PubChem CID | 25453222 |
| Molecular Formula | C18H22N4O2S |
| Molecular Weight | 358.47 g/mol |
| Exact Mass | 358.15 |
| IUPAC Name | N-[[2-(4-acetylpiperazin-1-yl)-3-pyridinyl]methyl]-5-methylthiophene-2-carboxamide |
| SMILES | CC(=O)N1CCN(c2ncccc2CNC(=O)c2ccc(C)s2)CC1 |
| InChI | InChI=1S/C18H22N4O2S/c1-13-5-6-16(25-13)18(24)20-12-15-4-3-7-19-17(15)22-10-8-21(9-11-22)14(2)23/h3-7H,8-12H2,1-2H3,(H,20,24) |
| InChIKey | HFLLRYGUOPNASP-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 65.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.47 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |