C19H20N4O2 — CID 18147602
2-(4-oxopyrido[2,3-d]pyrimidin-3-yl)-N-(4-phenylbutan-2-yl)acetamide (PubChem CID 18147602) has the molecular formula C19H20N4O2 and a molecular weight of 336.40 g/mol. Its IUPAC name is 2-(4-oxopyrido[2,3-d]pyrimidin-3-yl)-N-(4-phenylbutan-2-yl)acetamide.
| Compound Name | 2-(4-oxopyrido[2,3-d]pyrimidin-3-yl)-N-(4-phenylbutan-2-yl)acetamide |
|---|---|
| PubChem CID | 18147602 |
| Molecular Formula | C19H20N4O2 |
| Molecular Weight | 336.40 g/mol |
| Exact Mass | 336.16 |
| IUPAC Name | 2-(4-oxopyrido[2,3-d]pyrimidin-3-yl)-N-(4-phenylbutan-2-yl)acetamide |
| SMILES | CC(CCc1ccccc1)NC(=O)Cn1cnc2ncccc2c1=O |
| InChI | InChI=1S/C19H20N4O2/c1-14(9-10-15-6-3-2-4-7-15)22-17(24)12-23-13-21-18-16(19(23)25)8-5-11-20-18/h2-8,11,13-14H,9-10,12H2,1H3,(H,22,24) |
| InChIKey | YJKDBXMNOIHJSQ-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 76.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.40 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |