C21H24N4O3 — CID 93060405
2-(4-ethyl-2,3-dioxopyrido[2,3-b]pyrazin-1-yl)-N-[(2R)-4-phenylbutan-2-yl]acetamide (PubChem CID 93060405) has the molecular formula C21H24N4O3 and a molecular weight of 380.45 g/mol. Its IUPAC name is 2-(4-ethyl-2,3-dioxopyrido[2,3-b]pyrazin-1-yl)-N-[(2R)-4-phenylbutan-2-yl]acetamide.
| Compound Name | 2-(4-ethyl-2,3-dioxopyrido[2,3-b]pyrazin-1-yl)-N-[(2R)-4-phenylbutan-2-yl]acetamide |
|---|---|
| PubChem CID | 93060405 |
| Molecular Formula | C21H24N4O3 |
| Molecular Weight | 380.45 g/mol |
| Exact Mass | 380.18 |
| IUPAC Name | 2-(4-ethyl-2,3-dioxopyrido[2,3-b]pyrazin-1-yl)-N-[(2R)-4-phenylbutan-2-yl]acetamide |
| SMILES | CCn1c(=O)c(=O)n(CC(=O)N[C@H](C)CCc2ccccc2)c2cccnc21 |
| InChI | InChI=1S/C21H24N4O3/c1-3-24-19-17(10-7-13-22-19)25(21(28)20(24)27)14-18(26)23-15(2)11-12-16-8-5-4-6-9-16/h4-10,13,15H,3,11-12,14H2,1-2H3,(H,23,26)/t15-/m1/s1 |
| InChIKey | KKYFPJLFXAEBAL-OAHLLOKOSA-N |
| XLogP | 1.72 |
| TPSA | 85.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.45 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|