C23H24N4O2 — CID 92687284
3-(7-oxo-2,8,10-triazatricyclo[7.4.0.02,6]trideca-1(9),3,5,10,12-pentaen-8-yl)-N-[(2S)-4-phenylbutan-2-yl]propanamide (PubChem CID 92687284) has the molecular formula C23H24N4O2 and a molecular weight of 388.47 g/mol. Its IUPAC name is 3-(7-oxo-2,8,10-triazatricyclo[7.4.0.02,6]trideca-1(9),3,5,10,12-pentaen-8-yl)-N-[(2S)-4-phenylbutan-2-yl]propanamide.
| Compound Name | 3-(7-oxo-2,8,10-triazatricyclo[7.4.0.02,6]trideca-1(9),3,5,10,12-pentaen-8-yl)-N-[(2S)-4-phenylbutan-2-yl]propanamide |
|---|---|
| PubChem CID | 92687284 |
| Molecular Formula | C23H24N4O2 |
| Molecular Weight | 388.47 g/mol |
| Exact Mass | 388.19 |
| IUPAC Name | 3-(7-oxo-2,8,10-triazatricyclo[7.4.0.02,6]trideca-1(9),3,5,10,12-pentaen-8-yl)-N-[(2S)-4-phenylbutan-2-yl]propanamide |
| SMILES | C[C@@H](CCc1ccccc1)NC(=O)CCn1c(=O)c2cccn2c2cccnc21 |
| InChI | InChI=1S/C23H24N4O2/c1-17(11-12-18-7-3-2-4-8-18)25-21(28)13-16-27-22-19(9-5-14-24-22)26-15-6-10-20(26)23(27)29/h2-10,14-15,17H,11-13,16H2,1H3,(H,25,28)/t17-/m0/s1 |
| InChIKey | ICSKELJAZMPFEQ-KRWDZBQOSA-N |
| XLogP | 3.18 |
| TPSA | 68.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.47 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |