About N-[(3-bromophenyl)methyl]-2-(4-ethyl-2,3-dioxopyrido[2,3-b]pyrazin-1-yl)acetamide
N-[(3-bromophenyl)methyl]-2-(4-ethyl-2,3-dioxopyrido[2,3-b]pyrazin-1-yl)acetamide (PubChem CID 53001112) has the molecular formula C18H17BrN4O3
and a molecular weight of 417.26 g/mol. Its IUPAC name is N-[(3-bromophenyl)methyl]-2-(4-ethyl-2,3-dioxopyrido[2,3-b]pyrazin-1-yl)acetamide.
Molecular Properties
| Compound Name | N-[(3-bromophenyl)methyl]-2-(4-ethyl-2,3-dioxopyrido[2,3-b]pyrazin-1-yl)acetamide |
| PubChem CID | 53001112 |
| Molecular Formula | C18H17BrN4O3 |
| Molecular Weight | 417.26 g/mol |
| Exact Mass | 416.05 |
| IUPAC Name | N-[(3-bromophenyl)methyl]-2-(4-ethyl-2,3-dioxopyrido[2,3-b]pyrazin-1-yl)acetamide |
| SMILES | CCn1c(=O)c(=O)n(CC(=O)NCc2cccc(Br)c2)c2cccnc21 |
| InChI | InChI=1S/C18H17BrN4O3/c1-2-22-16-14(7-4-8-20-16)23(18(26)17(22)25)11-15(24)21-10-12-5-3-6-13(19)9-12/h3-9H,2,10-11H2,1H3,(H,21,24) |
| InChIKey | CLVBJRUPVUXTOQ-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 85.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 417.26 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|
Analyze N-[(3-bromophenyl)methyl]-2-(4-ethyl-2,3-dioxopyrido[2,3-b]pyrazin-1-yl)acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(3-bromophenyl)methyl]-2-(4-ethyl-2,3-dioxopyrido[2,3-b]pyrazin-1-yl)acetamide?
The IUPAC name of N-[(3-bromophenyl)methyl]-2-(4-ethyl-2,3-dioxopyrido[2,3-b]pyrazin-1-yl)acetamide (CID 53001112) is N-[(3-bromophenyl)methyl]-2-(4-ethyl-2,3-dioxopyrido[2,3-b]pyrazin-1-yl)acetamide.
What is the SMILES notation for N-[(3-bromophenyl)methyl]-2-(4-ethyl-2,3-dioxopyrido[2,3-b]pyrazin-1-yl)acetamide?
The canonical SMILES for N-[(3-bromophenyl)methyl]-2-(4-ethyl-2,3-dioxopyrido[2,3-b]pyrazin-1-yl)acetamide is CCn1c(=O)c(=O)n(CC(=O)NCc2cccc(Br)c2)c2cccnc21.
What is the InChIKey of N-[(3-bromophenyl)methyl]-2-(4-ethyl-2,3-dioxopyrido[2,3-b]pyrazin-1-yl)acetamide?
The InChIKey is CLVBJRUPVUXTOQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H17BrN4O3/c1-2-22-16-14(7-4-8-20-16)23(18(26)17(22)25)11-15(24)21-10-12-5-3-6-13(19)9-12/h3-9H,2,10-11H2,1H3,(H,21,24).
What are the key properties of N-[(3-bromophenyl)methyl]-2-(4-ethyl-2,3-dioxopyrido[2,3-b]pyrazin-1-yl)acetamide?
N-[(3-bromophenyl)methyl]-2-(4-ethyl-2,3-dioxopyrido[2,3-b]pyrazin-1-yl)acetamide has a molecular weight of 417.26 g/mol, XLogP of 1.66, 5 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(3-bromophenyl)methyl]-2-(4-ethyl-2,3-dioxopyrido[2,3-b]pyrazin-1-yl)acetamide is sourced from PubChem (CID 53001112), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).