C22H20N4O4 — CID 53030670
2-(4-benzyl-2,3-dioxopyrido[2,3-b]pyrazin-1-yl)-N-[(5-methylfuran-2-yl)methyl]acetamide (PubChem CID 53030670) has the molecular formula C22H20N4O4 and a molecular weight of 404.43 g/mol. Its IUPAC name is 2-(4-benzyl-2,3-dioxopyrido[2,3-b]pyrazin-1-yl)-N-[(5-methylfuran-2-yl)methyl]acetamide.
| Compound Name | 2-(4-benzyl-2,3-dioxopyrido[2,3-b]pyrazin-1-yl)-N-[(5-methylfuran-2-yl)methyl]acetamide |
|---|---|
| PubChem CID | 53030670 |
| Molecular Formula | C22H20N4O4 |
| Molecular Weight | 404.43 g/mol |
| Exact Mass | 404.15 |
| IUPAC Name | 2-(4-benzyl-2,3-dioxopyrido[2,3-b]pyrazin-1-yl)-N-[(5-methylfuran-2-yl)methyl]acetamide |
| SMILES | Cc1ccc(CNC(=O)Cn2c(=O)c(=O)n(Cc3ccccc3)c3ncccc32)o1 |
| InChI | InChI=1S/C22H20N4O4/c1-15-9-10-17(30-15)12-24-19(27)14-25-18-8-5-11-23-20(18)26(22(29)21(25)28)13-16-6-3-2-4-7-16/h2-11H,12-14H2,1H3,(H,24,27) |
| InChIKey | HPGDEMVEFOWGAN-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 99.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.43 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|