C25H24N4O3 — CID 53001131
2-(4-benzyl-2,3-dioxopyrido[2,3-b]pyrazin-1-yl)-N-(3-phenylpropyl)acetamide (PubChem CID 53001131) has the molecular formula C25H24N4O3 and a molecular weight of 428.49 g/mol. Its IUPAC name is 2-(4-benzyl-2,3-dioxopyrido[2,3-b]pyrazin-1-yl)-N-(3-phenylpropyl)acetamide.
| Compound Name | 2-(4-benzyl-2,3-dioxopyrido[2,3-b]pyrazin-1-yl)-N-(3-phenylpropyl)acetamide |
|---|---|
| PubChem CID | 53001131 |
| Molecular Formula | C25H24N4O3 |
| Molecular Weight | 428.49 g/mol |
| Exact Mass | 428.18 |
| IUPAC Name | 2-(4-benzyl-2,3-dioxopyrido[2,3-b]pyrazin-1-yl)-N-(3-phenylpropyl)acetamide |
| SMILES | O=C(Cn1c(=O)c(=O)n(Cc2ccccc2)c2ncccc21)NCCCc1ccccc1 |
| InChI | InChI=1S/C25H24N4O3/c30-22(26-15-7-13-19-9-3-1-4-10-19)18-28-21-14-8-16-27-23(21)29(25(32)24(28)31)17-20-11-5-2-6-12-20/h1-6,8-12,14,16H,7,13,15,17-18H2,(H,26,30) |
| InChIKey | NVOGAPVKUSCVIS-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 85.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.49 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|