C20H25N7O2 — CID 18150374
2-[4-(1-methylpyrazolo[5,4-d]pyrimidin-4-yl)piperazin-1-yl]-N-(2-phenoxyethyl)acetamide (PubChem CID 18150374) has the molecular formula C20H25N7O2 and a molecular weight of 395.47 g/mol. Its IUPAC name is 2-[4-(1-methylpyrazolo[5,4-d]pyrimidin-4-yl)piperazin-1-yl]-N-(2-phenoxyethyl)acetamide.
| Compound Name | 2-[4-(1-methylpyrazolo[5,4-d]pyrimidin-4-yl)piperazin-1-yl]-N-(2-phenoxyethyl)acetamide |
|---|---|
| PubChem CID | 18150374 |
| Molecular Formula | C20H25N7O2 |
| Molecular Weight | 395.47 g/mol |
| Exact Mass | 395.21 |
| IUPAC Name | 2-[4-(1-methylpyrazolo[5,4-d]pyrimidin-4-yl)piperazin-1-yl]-N-(2-phenoxyethyl)acetamide |
| SMILES | Cn1ncc2c(N3CCN(CC(=O)NCCOc4ccccc4)CC3)ncnc21 |
| InChI | InChI=1S/C20H25N7O2/c1-25-19-17(13-24-25)20(23-15-22-19)27-10-8-26(9-11-27)14-18(28)21-7-12-29-16-5-3-2-4-6-16/h2-6,13,15H,7-12,14H2,1H3,(H,21,28) |
| InChIKey | ADHSBGOVTZJDQX-UHFFFAOYSA-N |
| XLogP | 0.68 |
| TPSA | 88.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.47 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|