C28H33N7O2 — CID 53196577
N-[(4-butoxyphenyl)methyl]-2-[4-(4-phenylpiperazin-1-yl)pyrazolo[5,4-d]pyrimidin-1-yl]acetamide (PubChem CID 53196577) has the molecular formula C28H33N7O2 and a molecular weight of 499.62 g/mol. Its IUPAC name is N-[(4-butoxyphenyl)methyl]-2-[4-(4-phenylpiperazin-1-yl)pyrazolo[5,4-d]pyrimidin-1-yl]acetamide.
| Compound Name | N-[(4-butoxyphenyl)methyl]-2-[4-(4-phenylpiperazin-1-yl)pyrazolo[5,4-d]pyrimidin-1-yl]acetamide |
|---|---|
| PubChem CID | 53196577 |
| Molecular Formula | C28H33N7O2 |
| Molecular Weight | 499.62 g/mol |
| Exact Mass | 499.27 |
| IUPAC Name | N-[(4-butoxyphenyl)methyl]-2-[4-(4-phenylpiperazin-1-yl)pyrazolo[5,4-d]pyrimidin-1-yl]acetamide |
| SMILES | CCCCOc1ccc(CNC(=O)Cn2ncc3c(N4CCN(c5ccccc5)CC4)ncnc32)cc1 |
| InChI | InChI=1S/C28H33N7O2/c1-2-3-17-37-24-11-9-22(10-12-24)18-29-26(36)20-35-28-25(19-32-35)27(30-21-31-28)34-15-13-33(14-16-34)23-7-5-4-6-8-23/h4-12,19,21H,2-3,13-18,20H2,1H3,(H,29,36) |
| InChIKey | RFCBHSOESPVFTB-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 88.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.62 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|