C22H22N4O3 — CID 18153290
(E)-3-(3,5-dimethoxyphenyl)-1-(1-methyl-2,3-dihydropyrazino[2,3-b]quinoxalin-4-yl)prop-2-en-1-one (PubChem CID 18153290) has the molecular formula C22H22N4O3 and a molecular weight of 390.44 g/mol. Its IUPAC name is (E)-3-(3,5-dimethoxyphenyl)-1-(1-methyl-2,3-dihydropyrazino[2,3-b]quinoxalin-4-yl)prop-2-en-1-one.
| Compound Name | (E)-3-(3,5-dimethoxyphenyl)-1-(1-methyl-2,3-dihydropyrazino[2,3-b]quinoxalin-4-yl)prop-2-en-1-one |
|---|---|
| PubChem CID | 18153290 |
| Molecular Formula | C22H22N4O3 |
| Molecular Weight | 390.44 g/mol |
| Exact Mass | 390.17 |
| IUPAC Name | (E)-3-(3,5-dimethoxyphenyl)-1-(1-methyl-2,3-dihydropyrazino[2,3-b]quinoxalin-4-yl)prop-2-en-1-one |
| SMILES | COc1cc(/C=C/C(=O)N2CCN(C)c3nc4ccccc4nc32)cc(OC)c1 |
| InChI | InChI=1S/C22H22N4O3/c1-25-10-11-26(22-21(25)23-18-6-4-5-7-19(18)24-22)20(27)9-8-15-12-16(28-2)14-17(13-15)29-3/h4-9,12-14H,10-11H2,1-3H3/b9-8+ |
| InChIKey | ZFCOJKVOOKNQDX-CMDGGOBGSA-N |
| XLogP | 3.14 |
| TPSA | 67.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.44 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|