C25H23NO3 — CID 18153929
(1S,2R,6S,7R,8S,10R)-4-[4-(2,3-dimethylphenoxy)phenyl]-4-azatetracyclo[5.3.2.02,6.08,10]dodec-11-ene-3,5-dione (PubChem CID 18153929) has the molecular formula C25H23NO3 and a molecular weight of 385.46 g/mol. Its IUPAC name is (1S,2R,6S,7R,8S,10R)-4-[4-(2,3-dimethylphenoxy)phenyl]-4-azatetracyclo[5.3.2.02,6.08,10]dodec-11-ene-3,5-dione.
| Compound Name | (1S,2R,6S,7R,8S,10R)-4-[4-(2,3-dimethylphenoxy)phenyl]-4-azatetracyclo[5.3.2.02,6.08,10]dodec-11-ene-3,5-dione |
|---|---|
| PubChem CID | 18153929 |
| Molecular Formula | C25H23NO3 |
| Molecular Weight | 385.46 g/mol |
| Exact Mass | 385.17 |
| IUPAC Name | (1S,2R,6S,7R,8S,10R)-4-[4-(2,3-dimethylphenoxy)phenyl]-4-azatetracyclo[5.3.2.02,6.08,10]dodec-11-ene-3,5-dione |
| SMILES | Cc1cccc(Oc2ccc(N3C(=O)[C@@H]4[C@H]5C=C[C@H]([C@H]6C[C@@H]56)[C@@H]4C3=O)cc2)c1C |
| InChI | InChI=1S/C25H23NO3/c1-13-4-3-5-21(14(13)2)29-16-8-6-15(7-9-16)26-24(27)22-17-10-11-18(20-12-19(17)20)23(22)25(26)28/h3-11,17-20,22-23H,12H2,1-2H3/t17-,18+,19-,20+,22+,23- |
| InChIKey | ACRGBEQNXUSBQC-RVELUJESSA-N |
| XLogP | 4.65 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.46 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|