C29H27NO3 — CID 19644858
4-[4-(2,3-dimethylphenoxy)phenyl]-8-phenyl-4-azatricyclo[5.2.1.02,6]decane-3,5-dione (PubChem CID 19644858) has the molecular formula C29H27NO3 and a molecular weight of 437.54 g/mol. Its IUPAC name is 4-[4-(2,3-dimethylphenoxy)phenyl]-8-phenyl-4-azatricyclo[5.2.1.02,6]decane-3,5-dione.
| Compound Name | 4-[4-(2,3-dimethylphenoxy)phenyl]-8-phenyl-4-azatricyclo[5.2.1.02,6]decane-3,5-dione |
|---|---|
| PubChem CID | 19644858 |
| Molecular Formula | C29H27NO3 |
| Molecular Weight | 437.54 g/mol |
| Exact Mass | 437.20 |
| IUPAC Name | 4-[4-(2,3-dimethylphenoxy)phenyl]-8-phenyl-4-azatricyclo[5.2.1.02,6]decane-3,5-dione |
| SMILES | Cc1cccc(Oc2ccc(N3C(=O)C4C5CC(c6ccccc6)C(C5)C4C3=O)cc2)c1C |
| InChI | InChI=1S/C29H27NO3/c1-17-7-6-10-25(18(17)2)33-22-13-11-21(12-14-22)30-28(31)26-20-15-23(19-8-4-3-5-9-19)24(16-20)27(26)29(30)32/h3-14,20,23-24,26-27H,15-16H2,1-2H3 |
| InChIKey | ZMKHZWYCRDVTRU-UHFFFAOYSA-N |
| XLogP | 6.02 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.54 |
| LogP ≤ 5 | 6.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|