C14H15F3N4OS — CID 18158540
N-(1-cyanocyclohexyl)-2-[4-(trifluoromethyl)pyrimidin-2-yl]sulfanylacetamide (PubChem CID 18158540) has the molecular formula C14H15F3N4OS and a molecular weight of 344.36 g/mol. Its IUPAC name is N-(1-cyanocyclohexyl)-2-[4-(trifluoromethyl)pyrimidin-2-yl]sulfanylacetamide.
| Compound Name | N-(1-cyanocyclohexyl)-2-[4-(trifluoromethyl)pyrimidin-2-yl]sulfanylacetamide |
|---|---|
| PubChem CID | 18158540 |
| Molecular Formula | C14H15F3N4OS |
| Molecular Weight | 344.36 g/mol |
| Exact Mass | 344.09 |
| IUPAC Name | N-(1-cyanocyclohexyl)-2-[4-(trifluoromethyl)pyrimidin-2-yl]sulfanylacetamide |
| SMILES | N#CC1(NC(=O)CSc2nccc(C(F)(F)F)n2)CCCCC1 |
| InChI | InChI=1S/C14H15F3N4OS/c15-14(16,17)10-4-7-19-12(20-10)23-8-11(22)21-13(9-18)5-2-1-3-6-13/h4,7H,1-3,5-6,8H2,(H,21,22) |
| InChIKey | UGNDBUIUNHBAJH-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 78.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.36 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |