C20H24N4O4 — CID 18158810
[1-[2-[2-(2,6-dimethylphenoxy)acetyl]hydrazinyl]-1-oxo-3-phenylpropan-2-yl]urea (PubChem CID 18158810) has the molecular formula C20H24N4O4 and a molecular weight of 384.44 g/mol. Its IUPAC name is [1-[2-[2-(2,6-dimethylphenoxy)acetyl]hydrazinyl]-1-oxo-3-phenylpropan-2-yl]urea.
| Compound Name | [1-[2-[2-(2,6-dimethylphenoxy)acetyl]hydrazinyl]-1-oxo-3-phenylpropan-2-yl]urea |
|---|---|
| PubChem CID | 18158810 |
| Molecular Formula | C20H24N4O4 |
| Molecular Weight | 384.44 g/mol |
| Exact Mass | 384.18 |
| IUPAC Name | [1-[2-[2-(2,6-dimethylphenoxy)acetyl]hydrazinyl]-1-oxo-3-phenylpropan-2-yl]urea |
| SMILES | Cc1cccc(C)c1OCC(=O)NNC(=O)C(Cc1ccccc1)NC(N)=O |
| InChI | InChI=1S/C20H24N4O4/c1-13-7-6-8-14(2)18(13)28-12-17(25)23-24-19(26)16(22-20(21)27)11-15-9-4-3-5-10-15/h3-10,16H,11-12H2,1-2H3,(H,23,25)(H,24,26)(H3,21,22,27) |
| InChIKey | VVICMWJPQYMATQ-UHFFFAOYSA-N |
| XLogP | 1.11 |
| TPSA | 122.55 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.44 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|