C15H22BrFN2O — CID 18160843
2-bromo-N-[2-[di(propan-2-yl)amino]ethyl]-5-fluorobenzamide (PubChem CID 18160843) has the molecular formula C15H22BrFN2O and a molecular weight of 345.26 g/mol. Its IUPAC name is 2-bromo-N-[2-[di(propan-2-yl)amino]ethyl]-5-fluorobenzamide.
| Compound Name | 2-bromo-N-[2-[di(propan-2-yl)amino]ethyl]-5-fluorobenzamide |
|---|---|
| PubChem CID | 18160843 |
| Molecular Formula | C15H22BrFN2O |
| Molecular Weight | 345.26 g/mol |
| Exact Mass | 344.09 |
| IUPAC Name | 2-bromo-N-[2-[di(propan-2-yl)amino]ethyl]-5-fluorobenzamide |
| SMILES | CC(C)N(CCNC(=O)c1cc(F)ccc1Br)C(C)C |
| InChI | InChI=1S/C15H22BrFN2O/c1-10(2)19(11(3)4)8-7-18-15(20)13-9-12(17)5-6-14(13)16/h5-6,9-11H,7-8H2,1-4H3,(H,18,20) |
| InChIKey | HHUHSDIOTLJSSH-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.26 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |