C16H25FN2O2 — CID 34819371
N-[2-[di(propan-2-yl)amino]ethyl]-5-fluoro-2-methoxybenzamide (PubChem CID 34819371) has the molecular formula C16H25FN2O2 and a molecular weight of 296.39 g/mol. Its IUPAC name is N-[2-[di(propan-2-yl)amino]ethyl]-5-fluoro-2-methoxybenzamide.
| Compound Name | N-[2-[di(propan-2-yl)amino]ethyl]-5-fluoro-2-methoxybenzamide |
|---|---|
| PubChem CID | 34819371 |
| Molecular Formula | C16H25FN2O2 |
| Molecular Weight | 296.39 g/mol |
| Exact Mass | 296.19 |
| IUPAC Name | N-[2-[di(propan-2-yl)amino]ethyl]-5-fluoro-2-methoxybenzamide |
| SMILES | COc1ccc(F)cc1C(=O)NCCN(C(C)C)C(C)C |
| InChI | InChI=1S/C16H25FN2O2/c1-11(2)19(12(3)4)9-8-18-16(20)14-10-13(17)6-7-15(14)21-5/h6-7,10-12H,8-9H2,1-5H3,(H,18,20) |
| InChIKey | KBMDXLMTFVCFOJ-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.39 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |