C18H19FN4OS — CID 18161807
N-[2-(dimethylamino)-2-thiophen-2-ylethyl]-3-(4-fluorophenyl)imidazole-4-carboxamide (PubChem CID 18161807) has the molecular formula C18H19FN4OS and a molecular weight of 358.44 g/mol. Its IUPAC name is N-[2-(dimethylamino)-2-thiophen-2-ylethyl]-3-(4-fluorophenyl)imidazole-4-carboxamide.
| Compound Name | N-[2-(dimethylamino)-2-thiophen-2-ylethyl]-3-(4-fluorophenyl)imidazole-4-carboxamide |
|---|---|
| PubChem CID | 18161807 |
| Molecular Formula | C18H19FN4OS |
| Molecular Weight | 358.44 g/mol |
| Exact Mass | 358.13 |
| IUPAC Name | N-[2-(dimethylamino)-2-thiophen-2-ylethyl]-3-(4-fluorophenyl)imidazole-4-carboxamide |
| SMILES | CN(C)C(CNC(=O)c1cncn1-c1ccc(F)cc1)c1cccs1 |
| InChI | InChI=1S/C18H19FN4OS/c1-22(2)15(17-4-3-9-25-17)11-21-18(24)16-10-20-12-23(16)14-7-5-13(19)6-8-14/h3-10,12,15H,11H2,1-2H3,(H,21,24) |
| InChIKey | MXCFXPKUSSTCPM-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 50.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.44 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |