C19H18N4OS — CID 18165365
1-(2,3-dihydroindol-1-yl)-2-[3-(4-methylphenyl)-5-sulfanylidene-1H-1,2,4-triazol-4-yl]ethanone (PubChem CID 18165365) has the molecular formula C19H18N4OS and a molecular weight of 350.45 g/mol. Its IUPAC name is 1-(2,3-dihydroindol-1-yl)-2-[3-(4-methylphenyl)-5-sulfanylidene-1H-1,2,4-triazol-4-yl]ethanone.
| Compound Name | 1-(2,3-dihydroindol-1-yl)-2-[3-(4-methylphenyl)-5-sulfanylidene-1H-1,2,4-triazol-4-yl]ethanone |
|---|---|
| PubChem CID | 18165365 |
| Molecular Formula | C19H18N4OS |
| Molecular Weight | 350.45 g/mol |
| Exact Mass | 350.12 |
| IUPAC Name | 1-(2,3-dihydroindol-1-yl)-2-[3-(4-methylphenyl)-5-sulfanylidene-1H-1,2,4-triazol-4-yl]ethanone |
| SMILES | Cc1ccc(-c2n[nH]c(=S)n2CC(=O)N2CCc3ccccc32)cc1 |
| InChI | InChI=1S/C19H18N4OS/c1-13-6-8-15(9-7-13)18-20-21-19(25)23(18)12-17(24)22-11-10-14-4-2-3-5-16(14)22/h2-9H,10-12H2,1H3,(H,21,25) |
| InChIKey | WHOVKNQLPBHDIZ-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 53.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.45 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|