C15H9F3N4O2 — CID 18165536
2-(4-oxopyrido[2,3-d]pyrimidin-3-yl)-N-(2,3,4-trifluorophenyl)acetamide (PubChem CID 18165536) has the molecular formula C15H9F3N4O2 and a molecular weight of 334.26 g/mol. Its IUPAC name is 2-(4-oxopyrido[2,3-d]pyrimidin-3-yl)-N-(2,3,4-trifluorophenyl)acetamide.
| Compound Name | 2-(4-oxopyrido[2,3-d]pyrimidin-3-yl)-N-(2,3,4-trifluorophenyl)acetamide |
|---|---|
| PubChem CID | 18165536 |
| Molecular Formula | C15H9F3N4O2 |
| Molecular Weight | 334.26 g/mol |
| Exact Mass | 334.07 |
| IUPAC Name | 2-(4-oxopyrido[2,3-d]pyrimidin-3-yl)-N-(2,3,4-trifluorophenyl)acetamide |
| SMILES | O=C(Cn1cnc2ncccc2c1=O)Nc1ccc(F)c(F)c1F |
| InChI | InChI=1S/C15H9F3N4O2/c16-9-3-4-10(13(18)12(9)17)21-11(23)6-22-7-20-14-8(15(22)24)2-1-5-19-14/h1-5,7H,6H2,(H,21,23) |
| InChIKey | YXJHHKQSUZJIQG-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 76.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.26 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|