C17H23ClN4O2 — CID 18166272
2-[2-(4-chlorophenoxy)ethyl-methylamino]-N-(2-propan-2-ylpyrazol-3-yl)acetamide (PubChem CID 18166272) has the molecular formula C17H23ClN4O2 and a molecular weight of 350.85 g/mol. Its IUPAC name is 2-[2-(4-chlorophenoxy)ethyl-methylamino]-N-(2-propan-2-ylpyrazol-3-yl)acetamide.
| Compound Name | 2-[2-(4-chlorophenoxy)ethyl-methylamino]-N-(2-propan-2-ylpyrazol-3-yl)acetamide |
|---|---|
| PubChem CID | 18166272 |
| Molecular Formula | C17H23ClN4O2 |
| Molecular Weight | 350.85 g/mol |
| Exact Mass | 350.15 |
| IUPAC Name | 2-[2-(4-chlorophenoxy)ethyl-methylamino]-N-(2-propan-2-ylpyrazol-3-yl)acetamide |
| SMILES | CC(C)n1nccc1NC(=O)CN(C)CCOc1ccc(Cl)cc1 |
| InChI | InChI=1S/C17H23ClN4O2/c1-13(2)22-16(8-9-19-22)20-17(23)12-21(3)10-11-24-15-6-4-14(18)5-7-15/h4-9,13H,10-12H2,1-3H3,(H,20,23) |
| InChIKey | BEOBYZJSMNTZSR-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 59.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.85 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |