C23H24N2O4 — CID 18169764
[2-[(1-benzylpyrrolidin-3-yl)amino]-2-oxoethyl] 2H-chromene-3-carboxylate (PubChem CID 18169764) has the molecular formula C23H24N2O4 and a molecular weight of 392.46 g/mol. Its IUPAC name is [2-[(1-benzylpyrrolidin-3-yl)amino]-2-oxoethyl] 2H-chromene-3-carboxylate.
| Compound Name | [2-[(1-benzylpyrrolidin-3-yl)amino]-2-oxoethyl] 2H-chromene-3-carboxylate |
|---|---|
| PubChem CID | 18169764 |
| Molecular Formula | C23H24N2O4 |
| Molecular Weight | 392.46 g/mol |
| Exact Mass | 392.17 |
| IUPAC Name | [2-[(1-benzylpyrrolidin-3-yl)amino]-2-oxoethyl] 2H-chromene-3-carboxylate |
| SMILES | O=C(COC(=O)C1=Cc2ccccc2OC1)NC1CCN(Cc2ccccc2)C1 |
| InChI | InChI=1S/C23H24N2O4/c26-22(24-20-10-11-25(14-20)13-17-6-2-1-3-7-17)16-29-23(27)19-12-18-8-4-5-9-21(18)28-15-19/h1-9,12,20H,10-11,13-16H2,(H,24,26) |
| InChIKey | PQZHAHAZSZQTLT-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.46 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |