C17H14FN3O2S — CID 18171664
2-[(5-acetyl-3-cyano-6-methyl-2-pyridinyl)sulfanyl]-N-(3-fluorophenyl)acetamide (PubChem CID 18171664) has the molecular formula C17H14FN3O2S and a molecular weight of 343.38 g/mol. Its IUPAC name is 2-[(5-acetyl-3-cyano-6-methyl-2-pyridinyl)sulfanyl]-N-(3-fluorophenyl)acetamide.
| Compound Name | 2-[(5-acetyl-3-cyano-6-methyl-2-pyridinyl)sulfanyl]-N-(3-fluorophenyl)acetamide |
|---|---|
| PubChem CID | 18171664 |
| Molecular Formula | C17H14FN3O2S |
| Molecular Weight | 343.38 g/mol |
| Exact Mass | 343.08 |
| IUPAC Name | 2-[(5-acetyl-3-cyano-6-methyl-2-pyridinyl)sulfanyl]-N-(3-fluorophenyl)acetamide |
| SMILES | CC(=O)c1cc(C#N)c(SCC(=O)Nc2cccc(F)c2)nc1C |
| InChI | InChI=1S/C17H14FN3O2S/c1-10-15(11(2)22)6-12(8-19)17(20-10)24-9-16(23)21-14-5-3-4-13(18)7-14/h3-7H,9H2,1-2H3,(H,21,23) |
| InChIKey | UGKIMVABVUVOEK-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 82.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.38 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |