C16H21N3O2S — CID 18201845
2-[(5-acetyl-3-cyano-6-methyl-2-pyridinyl)sulfanyl]-N-(2-methylbutan-2-yl)acetamide (PubChem CID 18201845) has the molecular formula C16H21N3O2S and a molecular weight of 319.43 g/mol. Its IUPAC name is 2-[(5-acetyl-3-cyano-6-methyl-2-pyridinyl)sulfanyl]-N-(2-methylbutan-2-yl)acetamide.
| Compound Name | 2-[(5-acetyl-3-cyano-6-methyl-2-pyridinyl)sulfanyl]-N-(2-methylbutan-2-yl)acetamide |
|---|---|
| PubChem CID | 18201845 |
| Molecular Formula | C16H21N3O2S |
| Molecular Weight | 319.43 g/mol |
| Exact Mass | 319.14 |
| IUPAC Name | 2-[(5-acetyl-3-cyano-6-methyl-2-pyridinyl)sulfanyl]-N-(2-methylbutan-2-yl)acetamide |
| SMILES | CCC(C)(C)NC(=O)CSc1nc(C)c(C(C)=O)cc1C#N |
| InChI | InChI=1S/C16H21N3O2S/c1-6-16(4,5)19-14(21)9-22-15-12(8-17)7-13(11(3)20)10(2)18-15/h7H,6,9H2,1-5H3,(H,19,21) |
| InChIKey | AYZSQTVJBRYBFF-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 82.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.43 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |