C13H12Cl2N2OS — CID 51545387
5-acetyl-2-[[(1R)-2,2-dichlorocyclopropyl]methylsulfanyl]-6-methylpyridine-3-carbonitrile (PubChem CID 51545387) has the molecular formula C13H12Cl2N2OS and a molecular weight of 315.23 g/mol. Its IUPAC name is 5-acetyl-2-[[(1R)-2,2-dichlorocyclopropyl]methylsulfanyl]-6-methylpyridine-3-carbonitrile.
| Compound Name | 5-acetyl-2-[[(1R)-2,2-dichlorocyclopropyl]methylsulfanyl]-6-methylpyridine-3-carbonitrile |
|---|---|
| PubChem CID | 51545387 |
| Molecular Formula | C13H12Cl2N2OS |
| Molecular Weight | 315.23 g/mol |
| Exact Mass | 314.00 |
| IUPAC Name | 5-acetyl-2-[[(1R)-2,2-dichlorocyclopropyl]methylsulfanyl]-6-methylpyridine-3-carbonitrile |
| SMILES | CC(=O)c1cc(C#N)c(SC[C@H]2CC2(Cl)Cl)nc1C |
| InChI | InChI=1S/C13H12Cl2N2OS/c1-7-11(8(2)18)3-9(5-16)12(17-7)19-6-10-4-13(10,14)15/h3,10H,4,6H2,1-2H3/t10-/m1/s1 |
| InChIKey | LDJRPNQDCAFRPS-SNVBAGLBSA-N |
| XLogP | 3.75 |
| TPSA | 53.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.23 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|