About 5-acetyl-2-[[(1R)-2,2-dichlorocyclopropyl]methylsulfanyl]-6-methylpyridine-3-carbonitrile
5-acetyl-2-[[(1R)-2,2-dichlorocyclopropyl]methylsulfanyl]-6-methylpyridine-3-carbonitrile (PubChem CID 51545387) has the molecular formula C13H12Cl2N2OS
and a molecular weight of 315.23 g/mol. Its IUPAC name is 5-acetyl-2-[[(1R)-2,2-dichlorocyclopropyl]methylsulfanyl]-6-methylpyridine-3-carbonitrile.
Molecular Properties
| Compound Name | 5-acetyl-2-[[(1R)-2,2-dichlorocyclopropyl]methylsulfanyl]-6-methylpyridine-3-carbonitrile |
| PubChem CID | 51545387 |
| Molecular Formula | C13H12Cl2N2OS |
| Molecular Weight | 315.23 g/mol |
| Exact Mass | 314.00 |
| IUPAC Name | 5-acetyl-2-[[(1R)-2,2-dichlorocyclopropyl]methylsulfanyl]-6-methylpyridine-3-carbonitrile |
| SMILES | CC(=O)c1cc(C#N)c(SC[C@H]2CC2(Cl)Cl)nc1C |
| InChI | InChI=1S/C13H12Cl2N2OS/c1-7-11(8(2)18)3-9(5-16)12(17-7)19-6-10-4-13(10,14)15/h3,10H,4,6H2,1-2H3/t10-/m1/s1 |
| InChIKey | LDJRPNQDCAFRPS-SNVBAGLBSA-N |
| XLogP | 3.75 |
| TPSA | 53.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 315.23 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 5-acetyl-2-[[(1R)-2,2-dichlorocyclopropyl]methylsulfanyl]-6-methylpyridine-3-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-acetyl-2-[[(1R)-2,2-dichlorocyclopropyl]methylsulfanyl]-6-methylpyridine-3-carbonitrile?
The IUPAC name of 5-acetyl-2-[[(1R)-2,2-dichlorocyclopropyl]methylsulfanyl]-6-methylpyridine-3-carbonitrile (CID 51545387) is 5-acetyl-2-[[(1R)-2,2-dichlorocyclopropyl]methylsulfanyl]-6-methylpyridine-3-carbonitrile.
What is the SMILES notation for 5-acetyl-2-[[(1R)-2,2-dichlorocyclopropyl]methylsulfanyl]-6-methylpyridine-3-carbonitrile?
The canonical SMILES for 5-acetyl-2-[[(1R)-2,2-dichlorocyclopropyl]methylsulfanyl]-6-methylpyridine-3-carbonitrile is CC(=O)c1cc(C#N)c(SC[C@H]2CC2(Cl)Cl)nc1C.
What is the InChIKey of 5-acetyl-2-[[(1R)-2,2-dichlorocyclopropyl]methylsulfanyl]-6-methylpyridine-3-carbonitrile?
The InChIKey is LDJRPNQDCAFRPS-SNVBAGLBSA-N. The full InChI is InChI=1S/C13H12Cl2N2OS/c1-7-11(8(2)18)3-9(5-16)12(17-7)19-6-10-4-13(10,14)15/h3,10H,4,6H2,1-2H3/t10-/m1/s1.
What are the key properties of 5-acetyl-2-[[(1R)-2,2-dichlorocyclopropyl]methylsulfanyl]-6-methylpyridine-3-carbonitrile?
5-acetyl-2-[[(1R)-2,2-dichlorocyclopropyl]methylsulfanyl]-6-methylpyridine-3-carbonitrile has a molecular weight of 315.23 g/mol, XLogP of 3.75, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-acetyl-2-[[(1R)-2,2-dichlorocyclopropyl]methylsulfanyl]-6-methylpyridine-3-carbonitrile is sourced from PubChem (CID 51545387), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).