C18H17BrN4O4 — CID 18173231
2-[(4-bromophenoxy)methyl]-N-hydroxy-4-(4-oxo-1,2,3-benzotriazin-3-yl)butanamide (PubChem CID 18173231) has the molecular formula C18H17BrN4O4 and a molecular weight of 433.26 g/mol. Its IUPAC name is 2-[(4-bromophenoxy)methyl]-N-hydroxy-4-(4-oxo-1,2,3-benzotriazin-3-yl)butanamide.
| Compound Name | 2-[(4-bromophenoxy)methyl]-N-hydroxy-4-(4-oxo-1,2,3-benzotriazin-3-yl)butanamide |
|---|---|
| PubChem CID | 18173231 |
| Molecular Formula | C18H17BrN4O4 |
| Molecular Weight | 433.26 g/mol |
| Exact Mass | 432.04 |
| IUPAC Name | 2-[(4-bromophenoxy)methyl]-N-hydroxy-4-(4-oxo-1,2,3-benzotriazin-3-yl)butanamide |
| SMILES | O=C(NO)C(CCn1nnc2ccccc2c1=O)COc1ccc(Br)cc1 |
| InChI | InChI=1S/C18H17BrN4O4/c19-13-5-7-14(8-6-13)27-11-12(17(24)21-26)9-10-23-18(25)15-3-1-2-4-16(15)20-22-23/h1-8,12,26H,9-11H2,(H,21,24) |
| InChIKey | ZCURFDCZLQMRHT-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 106.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.26 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|