C8H5F13O — CID 18179202
1,1,2,2,3,3,4,4,5,5,6,6,7-tridecafluorooctan-1-ol (PubChem CID 18179202) has the molecular formula C8H5F13O and a molecular weight of 364.10 g/mol. Its IUPAC name is 1,1,2,2,3,3,4,4,5,5,6,6,7-tridecafluorooctan-1-ol.
| Compound Name | 1,1,2,2,3,3,4,4,5,5,6,6,7-tridecafluorooctan-1-ol |
|---|---|
| PubChem CID | 18179202 |
| Molecular Formula | C8H5F13O |
| Molecular Weight | 364.10 g/mol |
| Exact Mass | 364.01 |
| IUPAC Name | 1,1,2,2,3,3,4,4,5,5,6,6,7-tridecafluorooctan-1-ol |
| SMILES | CC(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(O)(F)F |
| InChI | InChI=1S/C8H5F13O/c1-2(9)3(10,11)4(12,13)5(14,15)6(16,17)7(18,19)8(20,21)22/h2,22H,1H3 |
| InChIKey | KIRIXOGQHXHZKY-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.10 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|