C16H19N3OS3 — CID 18180759
N-(2-methyl-1-azabicyclo[2.2.2]octan-3-yl)-5-(1,3-thiazol-2-ylsulfanyl)thiophene-2-carboxamide (PubChem CID 18180759) has the molecular formula C16H19N3OS3 and a molecular weight of 365.55 g/mol. Its IUPAC name is N-(2-methyl-1-azabicyclo[2.2.2]octan-3-yl)-5-(1,3-thiazol-2-ylsulfanyl)thiophene-2-carboxamide.
| Compound Name | N-(2-methyl-1-azabicyclo[2.2.2]octan-3-yl)-5-(1,3-thiazol-2-ylsulfanyl)thiophene-2-carboxamide |
|---|---|
| PubChem CID | 18180759 |
| Molecular Formula | C16H19N3OS3 |
| Molecular Weight | 365.55 g/mol |
| Exact Mass | 365.07 |
| IUPAC Name | N-(2-methyl-1-azabicyclo[2.2.2]octan-3-yl)-5-(1,3-thiazol-2-ylsulfanyl)thiophene-2-carboxamide |
| SMILES | CC1C(NC(=O)c2ccc(Sc3nccs3)s2)C2CCN1CC2 |
| InChI | InChI=1S/C16H19N3OS3/c1-10-14(11-4-7-19(10)8-5-11)18-15(20)12-2-3-13(22-12)23-16-17-6-9-21-16/h2-3,6,9-11,14H,4-5,7-8H2,1H3,(H,18,20) |
| InChIKey | ZIFGZXAOHVOUCP-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 45.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.55 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thiazol_SC_A(3)', 'substructure': 'N/A'} |
|---|