C21H24N2O2S2 — CID 18399843
4-(5-acetylthiophen-2-yl)sulfanyl-N-(2-methyl-1-azabicyclo[2.2.2]octan-3-yl)benzamide (PubChem CID 18399843) has the molecular formula C21H24N2O2S2 and a molecular weight of 400.57 g/mol. Its IUPAC name is 4-(5-acetylthiophen-2-yl)sulfanyl-N-(2-methyl-1-azabicyclo[2.2.2]octan-3-yl)benzamide.
| Compound Name | 4-(5-acetylthiophen-2-yl)sulfanyl-N-(2-methyl-1-azabicyclo[2.2.2]octan-3-yl)benzamide |
|---|---|
| PubChem CID | 18399843 |
| Molecular Formula | C21H24N2O2S2 |
| Molecular Weight | 400.57 g/mol |
| Exact Mass | 400.13 |
| IUPAC Name | 4-(5-acetylthiophen-2-yl)sulfanyl-N-(2-methyl-1-azabicyclo[2.2.2]octan-3-yl)benzamide |
| SMILES | CC(=O)c1ccc(Sc2ccc(C(=O)NC3C4CCN(CC4)C3C)cc2)s1 |
| InChI | InChI=1S/C21H24N2O2S2/c1-13-20(15-9-11-23(13)12-10-15)22-21(25)16-3-5-17(6-4-16)26-19-8-7-18(27-19)14(2)24/h3-8,13,15,20H,9-12H2,1-2H3,(H,22,25) |
| InChIKey | JHDMZJHDKARNGV-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.57 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |