C23H27N3O2S — CID 18383586
4-(3-acetamidophenyl)sulfanyl-N-(2-methyl-1-azabicyclo[2.2.2]octan-3-yl)benzamide (PubChem CID 18383586) has the molecular formula C23H27N3O2S and a molecular weight of 409.56 g/mol. Its IUPAC name is 4-(3-acetamidophenyl)sulfanyl-N-(2-methyl-1-azabicyclo[2.2.2]octan-3-yl)benzamide.
| Compound Name | 4-(3-acetamidophenyl)sulfanyl-N-(2-methyl-1-azabicyclo[2.2.2]octan-3-yl)benzamide |
|---|---|
| PubChem CID | 18383586 |
| Molecular Formula | C23H27N3O2S |
| Molecular Weight | 409.56 g/mol |
| Exact Mass | 409.18 |
| IUPAC Name | 4-(3-acetamidophenyl)sulfanyl-N-(2-methyl-1-azabicyclo[2.2.2]octan-3-yl)benzamide |
| SMILES | CC(=O)Nc1cccc(Sc2ccc(C(=O)NC3C4CCN(CC4)C3C)cc2)c1 |
| InChI | InChI=1S/C23H27N3O2S/c1-15-22(17-10-12-26(15)13-11-17)25-23(28)18-6-8-20(9-7-18)29-21-5-3-4-19(14-21)24-16(2)27/h3-9,14-15,17,22H,10-13H2,1-2H3,(H,24,27)(H,25,28) |
| InChIKey | JUKOJONEKPWAPL-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.56 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |