C14H28N6O2 — CID 18183018
N',N'-bis(1-imidazolidin-1-ylpropyl)oxamide (PubChem CID 18183018) has the molecular formula C14H28N6O2 and a molecular weight of 312.42 g/mol. Its IUPAC name is N',N'-bis(1-imidazolidin-1-ylpropyl)oxamide.
| Compound Name | N',N'-bis(1-imidazolidin-1-ylpropyl)oxamide |
|---|---|
| PubChem CID | 18183018 |
| Molecular Formula | C14H28N6O2 |
| Molecular Weight | 312.42 g/mol |
| Exact Mass | 312.23 |
| IUPAC Name | N',N'-bis(1-imidazolidin-1-ylpropyl)oxamide |
| SMILES | CCC(N1CCNC1)N(C(=O)C(N)=O)C(CC)N1CCNC1 |
| InChI | InChI=1S/C14H28N6O2/c1-3-11(18-7-5-16-9-18)20(14(22)13(15)21)12(4-2)19-8-6-17-10-19/h11-12,16-17H,3-10H2,1-2H3,(H2,15,21) |
| InChIKey | CFADWHYTWVZIBX-UHFFFAOYSA-N |
| XLogP | -1.50 |
| TPSA | 93.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.42 |
| LogP ≤ 5 | -1.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|