C10H21N5O — CID 57104434
2,2-di(piperazin-1-yl)acetamide (PubChem CID 57104434) has the molecular formula C10H21N5O and a molecular weight of 227.31 g/mol. Its IUPAC name is 2,2-di(piperazin-1-yl)acetamide.
| Compound Name | 2,2-di(piperazin-1-yl)acetamide |
|---|---|
| PubChem CID | 57104434 |
| Molecular Formula | C10H21N5O |
| Molecular Weight | 227.31 g/mol |
| Exact Mass | 227.17 |
| IUPAC Name | 2,2-di(piperazin-1-yl)acetamide |
| SMILES | NC(=O)C(N1CCNCC1)N1CCNCC1 |
| InChI | InChI=1S/C10H21N5O/c11-9(16)10(14-5-1-12-2-6-14)15-7-3-13-4-8-15/h10,12-13H,1-8H2,(H2,11,16) |
| InChIKey | MTVPRBAQAIKDDJ-UHFFFAOYSA-N |
| XLogP | -2.39 |
| TPSA | 73.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.31 |
| LogP ≤ 5 | -2.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |