C12H17N3O3 — CID 54892096
2-(3,4-dihydroxyphenyl)-2-piperazin-1-ylacetamide (PubChem CID 54892096) has the molecular formula C12H17N3O3 and a molecular weight of 251.29 g/mol. Its IUPAC name is 2-(3,4-dihydroxyphenyl)-2-piperazin-1-ylacetamide.
| Compound Name | 2-(3,4-dihydroxyphenyl)-2-piperazin-1-ylacetamide |
|---|---|
| PubChem CID | 54892096 |
| Molecular Formula | C12H17N3O3 |
| Molecular Weight | 251.29 g/mol |
| Exact Mass | 251.13 |
| IUPAC Name | 2-(3,4-dihydroxyphenyl)-2-piperazin-1-ylacetamide |
| SMILES | NC(=O)C(c1ccc(O)c(O)c1)N1CCNCC1 |
| InChI | InChI=1S/C12H17N3O3/c13-12(18)11(15-5-3-14-4-6-15)8-1-2-9(16)10(17)7-8/h1-2,7,11,14,16-17H,3-6H2,(H2,13,18) |
| InChIKey | FZNQECSGAUSCNB-UHFFFAOYSA-N |
| XLogP | -0.47 |
| TPSA | 98.82 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.29 |
| LogP ≤ 5 | -0.47 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|