C14H21N3O3 — CID 60995776
2-(3,5-dimethoxyphenyl)-2-piperazin-1-ylacetamide (PubChem CID 60995776) has the molecular formula C14H21N3O3 and a molecular weight of 279.34 g/mol. Its IUPAC name is 2-(3,5-dimethoxyphenyl)-2-piperazin-1-ylacetamide.
| Compound Name | 2-(3,5-dimethoxyphenyl)-2-piperazin-1-ylacetamide |
|---|---|
| PubChem CID | 60995776 |
| Molecular Formula | C14H21N3O3 |
| Molecular Weight | 279.34 g/mol |
| Exact Mass | 279.16 |
| IUPAC Name | 2-(3,5-dimethoxyphenyl)-2-piperazin-1-ylacetamide |
| SMILES | COc1cc(OC)cc(C(C(N)=O)N2CCNCC2)c1 |
| InChI | InChI=1S/C14H21N3O3/c1-19-11-7-10(8-12(9-11)20-2)13(14(15)18)17-5-3-16-4-6-17/h7-9,13,16H,3-6H2,1-2H3,(H2,15,18) |
| InChIKey | QOSVMYRVBYZWQU-UHFFFAOYSA-N |
| XLogP | 0.14 |
| TPSA | 76.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.34 |
| LogP ≤ 5 | 0.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |