C11H9F3N2O4S — CID 18185363
1-ethyl-5-(trifluoromethylsulfonyl)benzimidazole-2-carboxylic acid (PubChem CID 18185363) has the molecular formula C11H9F3N2O4S and a molecular weight of 322.26 g/mol. Its IUPAC name is 1-ethyl-5-(trifluoromethylsulfonyl)benzimidazole-2-carboxylic acid.
| Compound Name | 1-ethyl-5-(trifluoromethylsulfonyl)benzimidazole-2-carboxylic acid |
|---|---|
| PubChem CID | 18185363 |
| Molecular Formula | C11H9F3N2O4S |
| Molecular Weight | 322.26 g/mol |
| Exact Mass | 322.02 |
| IUPAC Name | 1-ethyl-5-(trifluoromethylsulfonyl)benzimidazole-2-carboxylic acid |
| SMILES | CCn1c(C(=O)O)nc2cc(S(=O)(=O)C(F)(F)F)ccc21 |
| InChI | InChI=1S/C11H9F3N2O4S/c1-2-16-8-4-3-6(21(19,20)11(12,13)14)5-7(8)15-9(16)10(17)18/h3-5H,2H2,1H3,(H,17,18) |
| InChIKey | RYDVNOYKRIEKLX-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 89.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.26 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |